2,4-Dichlorothieno[2,3-d]pyrimidine is a chemical compound used primarily as a research reagent. It features a bicyclic structure containing both sulfur and nitrogen atoms, along with two chlorine substituents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 18740-39-1
1-(3-fluorophenyl)-2-((2-hydroxyethyl)amino)propan-1-ol
Organic synthesis research reagent
3-Nitrophenylacetic acid
organic synthesis intermediate herbicidal reagent
2-[[(2S)-2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid
research compound
4-Bromophenylacetic acid
monocarboxylic acid research reagent
2,4-dichlorothieno[2,3-d]pyrimidine
HRXNGIQKOWQHCX-UHFFFAOYSA-N
C1=CSC2=C1C(=NC(=N2)Cl)Cl
—