3-Nitrophenylacetic acid is an organic compound used in organic synthesis and as a herbicidal reagent. It is a derivative of phenylacetic acid containing a nitro group on the aromatic ring, and serves as a key intermediate in the formation of heterocyclic compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1877-73-2
2-[[(2S)-2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid
research compound
4-Bromophenylacetic acid
monocarboxylic acid research reagent
1-Bromooctadecane-d37
deuterated research compound
Acetylcorynoline
reference standard for alkaloid analysis
2-(3-nitrophenyl)acetic acid
WUKHOVCMWXMOOA-UHFFFAOYSA-N
C1=CC(=CC(=C1)[N+](=O)[O-])CC(=O)O