This compound is a protected peptide derivative used as a research reagent. It features a tert-butyloxycarbonyl (Boc) protecting group and multiple amide bonds, along with a single aromatic ring, making it suitable for peptide chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 187794-49-6
4-Bromophenylacetic acid
monocarboxylic acid research reagent
1-Bromooctadecane-d37
deuterated research compound
Acetylcorynoline
reference standard for alkaloid analysis
L-Alanine-d4
deuterated analytical reference standard
2-[[(2S)-2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid
PTUJJIPXBJJLLV-AWEZNQCLSA-N
CC(C)(C)OC(=O)NCC(=O)NCC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)NCC(=O)O