tert-butyl (2R)-2-methylpiperazine-1-carboxylate is a chemical compound used as a pharmaceutical intermediate. It features a piperazine ring with a tert-butoxycarbonyl (Boc) protective group and a methyl substituent, making it valuable in drug synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 170033-47-3
Tert-butyl (3R,4S)-3-amino-4-fluoropiperidine-1-carboxylate
Pharmaceutical intermediate
(2R)-2-Amino-3-((1,1'-biphenyl)-4-yl)propanoic acid
Pharmaceutical intermediate for peptide synthesis
(R)-3-(4-Phenoxyphenyl)-1-(piperidin-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine dihydrochloride
pharmaceutical intermediate
2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolane-4-methanol, (2R,4S)-(+-)--
Pharmaceutical intermediate for antifungal agents
Tert-butyl (2S)-2-methylpiperazine-1-carboxylate
pharmaceutical intermediate for synthesis
tert-butyl (2R)-2-methylpiperazine-1-carboxylate
DATRVIMZZZVHMP-MRVPVSSYSA-N
C[C@@H]1CNCCN1C(=O)OC(C)(C)C