This compound is an amino acid derivative featuring a biphenyl side chain. It serves as a pharmaceutical intermediate, particularly employed in the synthesis of peptides for research and manufacturing applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 170080-13-4
L-Phenylalanine-1,2,3,4,5,6-13C6
isotope-labeled research reagent
فينيل ألانين
nutritional supplement and flavoring agent
D-phenylalanine
Antidepressant pharmaceutical ingredient
DL-PHENYLALANINE
nutrient and flavoring agent
(R)-3-(4-Phenoxyphenyl)-1-(piperidin-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine dihydrochloride
pharmaceutical intermediate
2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolane-4-methanol, (2R,4S)-(+-)--
Pharmaceutical intermediate for antifungal agents
Butanedioic acid, 2,3-bis(benzoyloxy)-, (2S,3S)-
chiral resolution agent
Vipivotide tetraxetan Linker
PSMA-targeted ligand-linker conjugate intermediate
(2R)-2-amino-3-(4-phenylphenyl)propanoic acid
JCZLABDVDPYLRZ-CQSZACIVSA-N
C1=CC=C(C=C1)C2=CC=C(C=C2)C[C@H](C(=O)O)N