This compound is a pharmaceutical intermediate featuring a chiral dioxolane ring with imidazole and dichlorophenyl substituents. It is primarily used for the laboratory-scale synthesis of antifungal agents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 170210-49-8
Ethyl 4-(4-hydroxyphenyl)piperazine-1-carboxylate
Pharmaceutical intermediate for antifungal agents
Butanedioic acid, 2,3-bis(benzoyloxy)-, (2S,3S)-
chiral resolution agent
Vipivotide tetraxetan Linker
PSMA-targeted ligand-linker conjugate intermediate
6-(1-Methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4(1H)-one
pharmaceutical intermediate
4-Chloro-6-(1-methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine
Pharmaceutical intermediate
[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol
VJZJGRMLFMJRGG-BXUZGUMPSA-N
C1[C@H](O[C@](O1)(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)CO