3-Fluoro-5-(trifluoromethyl)benzoic acid is a research compound primarily used in laboratory and manufacturing settings. It is a structurally distinct molecule from flufenamic acid, which is an anthranilic acid derivative and NSAID, but the two share certain structural features.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 161622-05-5
3,5-Bis(trifluoromethyl)benzoic acid
Pharmaceutical intermediate synthesis
4-Bromo-3-(trifluoromethyl)benzoic acid
research compound
(S)-1-BENZYL-PYRROLIDINE-3-CARBOXYLIC ACID
Research chemical
1,3-Dibromobenzene-d4
Deuterated research compound
3,4-Difluorohydrocinnamic acid
research compound
3-fluoro-5-(trifluoromethyl)benzoic acid
NSGKIIGVPBTOBF-UHFFFAOYSA-N
C1=C(C=C(C=C1C(F)(F)F)F)C(=O)O
—