3,5-Bis(trifluoromethyl)benzoic acid is a chemical compound featuring a benzoic acid core substituted with two trifluoromethyl groups at the 3 and 5 positions. It is primarily used as an intermediate in the synthesis of pharmaceutical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 725-89-3
3-Fluoro-5-(trifluoromethyl)benzoic acid
research compound
2-Bromo-1,1-dimethoxyethane
Bromoacetaldehyde dimethyl acetal intermediate
6-Methoxypyridazin-3-amine
Pharmaceutical intermediate
2'-Oxo Ifosfamide
Pharmaceutical intermediate for ifosfamide analogs
Ethyl N-(tert-butoxycarbonyl)-L-tyrosinate
protected amino acid intermediate
3,5-bis(trifluoromethyl)benzoic acid
HVFQJWGYVXKLTE-UHFFFAOYSA-N
C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)O