1,3-Dibromobenzene-d4 is a deuterated research compound in which all four hydrogen atoms on the benzene ring are replaced by deuterium. It is primarily used as a stable isotope-labeled reagent in analytical chemistry and organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1616983-07-3
3,4-Difluorohydrocinnamic acid
research compound
Adenosine, 5'-diphosphoric acid, disodium salt
research reagent for biochemical assays
6-(4-Hydroxyphenoxy)hexyl acrylate
chemical intermediate for research
O-Trifluoromethylpropiophenone
Research chemical for organic synthesis
1,3-DIBROMOBENZENE
chemical intermediate for synthesis
1,3-dibromo-2,4,5,6-tetradeuteriobenzene
JSRLURSZEMLAFO-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1[2H])Br)[2H])Br)[2H]