TDCPP (tris(1,3-dichloroisopropyl)phosphate) is a chlorinated organophosphate compound primarily used as a flame retardant in polyurethane foams. It is structurally related to other chlorinated flame retardants such as TCEP and TCPP.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13674-87-8
1,1'-(Methylenedi-p-phenylene)bismaleimide
intermediate for polymer synthesis
2,2,3,3,4,4,4-Heptafluorobutyl methacrylate
fluorinated monomer for polymer synthesis
2-Aminothiophenol
synthesis intermediate for chemical industry
N-Lauroylsarcosine sodium salt
surfactant and foaming agent
tris(1,3-dichloropropan-2-yl) phosphate
ASLWPAWFJZFCKF-UHFFFAOYSA-N
C(C(CCl)OP(=O)(OC(CCl)CCl)OC(CCl)CCl)Cl