2,2,3,3,4,4,4-Heptafluorobutyl methacrylate is a fluorinated monomer used in polymer synthesis. It features an ester functional group and multiple fluorine atoms, contributing to the properties of the resulting polymers.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13695-31-3
2-[(Pentafluoropropanoyl)oxy]ethyl methacrylate
fluorinated monomer for polymer synthesis
2-Aminothiophenol
synthesis intermediate for chemical industry
N-Lauroylsarcosine sodium salt
surfactant and foaming agent
Copper dimethyldithiocarbamate
Elastomer accelerator for rubber vulcanization
2-METHYL-1-BUTANOL
Solvent and chemical intermediate
2,2,3,3,4,4,4-heptafluorobutyl 2-methylprop-2-enoate
VIEHKBXCWMMOOU-UHFFFAOYSA-N
CC(=C)C(=O)OCC(C(C(F)(F)F)(F)F)(F)F