DiZPK is a photo-reactive amino acid probe containing a diazirine group that can be activated by UV light to form covalent crosslinks with nearby biomolecules. It is primarily used in chemical biology research to study protein-protein interactions and map proximity labeling in living cells.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1337883-32-5
Tert-Butyl 4-(4-hydroxy-2-oxo-1,2,3,4-tetrahydroquinolin-3-yl)piperidine-1-carboxylate
organic research compound
(6-bromopyridin-2-yl)(1-methylpiperidin-4-yl)methanone hydrobromide
Research reagent for chemical studies
1,2-dicervonoylglycerol
lipid research standard
1,2,3,4-Tetrahydro-1,5-naphthyridine hydrochloride
research compound
(2S)-2-amino-6-[3-(3-methyldiazirin-3-yl)propylcarbamoylamino]hexanoic acid
YGUIFRMUMYTGAV-VIFPVBQESA-N
CC1(N=N1)CCCNC(=O)NCCCC[C@@H](C(=O)O)N