1,2-dicervonoylglycerol is a long-chain diglyceride used as a research standard in lipid studies. Its structure features two docosahexaenoic acid chains esterified to a glycerol backbone, contributing to its high molecular weight and flexibility.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 133831-25-1
1,2,3,4-Tetrahydro-1,5-naphthyridine hydrochloride
research compound
2-Cyanoethyl (6-(2,2,2-trifluoroacetamido)hexyl) diisopropylphosphoramidite
solid-phase oligonucleotide synthesis reagent
2-oxaspiro[3.3]heptan-6-one
research reagent
بنزل
organic synthesis reagent
[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-hydroxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
XIAZEYRSKHAPND-GZSOIYOPSA-N
CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OCC(CO)OC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC