This compound is an organic salt, specifically the hydrobromide form of a brominated pyridine derivative. It is primarily encountered as a research reagent used in chemical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1338000-32-0
(6-Bromopyridin-2-yl)(1-methylpiperidin-4-yl)methanone
research compound
2-(Diethylamino)-6-methyl-1H-pyrimidin-4-one
Research reagent for chemical studies
1,2-dicervonoylglycerol
lipid research standard
1,2,3,4-Tetrahydro-1,5-naphthyridine hydrochloride
research compound
2-Cyanoethyl (6-(2,2,2-trifluoroacetamido)hexyl) diisopropylphosphoramidite
solid-phase oligonucleotide synthesis reagent
2-oxaspiro[3.3]heptan-6-one
research reagent
(6-Aminopyridin-2-yl)(1-methylpiperidin-4-yl)methanone
pharmaceutical intermediate
6-(1-methylpiperidine-4-carbonyl)pyridin-2-amine dihydrochloride
Research compound
(6-bromo-2-pyridinyl)-(1-methylpiperidin-4-yl)methanone;hydrobromide
UINYIZJEJDKZEY-UHFFFAOYSA-N
CN1CCC(CC1)C(=O)C2=NC(=CC=C2)Br.Br