Menaquinone 7-d7 is a stable isotope labeled research compound used primarily for analytical and investigative purposes. It is a deuterated form of menaquinone-7 that is used as an internal standard in mass spectrometry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1233937-31-9
1,14-TETRADECANEDIOIC-D24 ACID
stable isotope labeled research compound
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Palmitoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
4,6-Dichloro-1,3-dinitrobenzene-13C6
stable isotope labeled research compound
1-(5-Bromo-4-chlorothiophen-2-yl)ethan-1-one
research compound
XMD 8-92
protein kinase inhibitor research tool
2-Chloroethyl trityl ether
research compound
Pentamethylcyclopentadienyliridium dichloride
organometallic synthesis reagent
5,6,7,8-tetradeuterio-2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl]-3-(trideuteriomethyl)naphthalene-1,4-dione
RAKQPZMEYJZGPI-HRQALKRPSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=O)C(=C(C2=O)C([2H])([2H])[2H])C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)[2H])[2H]