2-Chloroethyl trityl ether is a research compound featuring a trityl group linked to a 2-chloroethyl ether moiety. It contains three aromatic rings, an ether linkage, and a chlorine atom, and is typically supplied as a laboratory reagent for synthetic chemistry applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1235-23-0
Pentamethylcyclopentadienyliridium dichloride
organometallic synthesis reagent
P7C3-A20
research compound
(4-(1-(2-cyano-1-cyclopentylethyl)-1h-pyrazol-4-yl)-7h-pyrrolo[2,3-d]pyrimidin-7-yl)methyl pivalate
research compound
N-(5-Methoxy-2-Phenoxyphenyl)methanesulfonamide
Research compound
[2-chloroethoxy(diphenyl)methyl]benzene
SYWFBBWOXLVTAN-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCCCl