4-Bromophenylalanine hydrochloride is a research reagent consisting of the hydrochloride salt of 4-bromo-L-phenylalanine, an amino acid derivative featuring a bromine substituent on the aromatic ring. It is primarily utilized as a building block or intermediate in laboratory and pharmaceutical research settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 122839-59-2
4-BROMO-L-PHENYLALANINE
Peptide building block pharmaceutical intermediate
(R)-3-((tert-Butoxycarbonyl)amino)-3-(4-ethylphenyl)propanoic acid
research compound for peptide synthesis
(R)-2-(1-Aminoethyl)-4-fluorophenol
research compound
6-Aminocaproic acid-d6
deuterated analytical research standard
Edaravone D5
Deuterated research compound
(R)-2-amino-3-(4-bromophenyl)propionic acid
Pharmaceutical intermediate
(2S)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride
GRWMPXZZFAPLFZ-QRPNPIFTSA-N
C1=CC(=CC=C1C[C@@H](C(=O)O)N)Br.Cl