Edaravone D5 is a deuterated form of the neuroprotective compound edaravone, used as a research reagent. Its primary significance lies in its role as an isotopically labeled analog for studying neuroprotection and oxidative stress pathways in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1228765-67-0
3,5-dibromopyridine-d3
Deuterated research compound
Cyclobutanone-2,2,4,4-d4
Deuterated research compound
4-Methoxyaniline--d4
Deuterated research compound
2-Aminohexane-d6
Deuterated research compound
Pioglitazone impurity 30
Pioglitazone impurity reference standard
(R)-N-[1-(5,6,7,8-Tetrahydronaphthalen-1-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]-1-propylamine
research reagent
(R)-1-(Naphthalen-1-yl)-N-(3-(trifluoromethyl)benzyl)ethanamine hydrochloride
Certified reference standard for impurity analysis
(2S,4R)-4-(tert-butoxy)-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}pyrrolidine-2-carboxylic acid
Fmoc-protected amino acid building block
5-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-4H-pyrazol-3-one
QELUYTUMUWHWMC-VIQYUKPQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])N2C(=O)CC(=N2)C)[2H])[2H]