Seco-DUBA is a chemical compound characterized by the presence of multiple amide, aromatic, and heterocyclic groups, along with a halogen atom, giving it a specific ring-containing and moderately polar structure. It is primarily recognized as a research reagent used in the context of antibody-drug conjugate development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1227961-59-2
MAC glucuronide phenol-linked SN-38
antibody-drug conjugate payload
4-pyridin-2-yloxycyclohexane-1-carbohydrazide
research compound
Cimaterol D7
deuterated analytical reference standard
4-bromophenylalanine hydrochloride
research compound
(R)-3-((tert-Butoxycarbonyl)amino)-3-(4-ethylphenyl)propanoic acid
research compound for peptide synthesis
N-[2-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]imidazo[1,2-a]pyridin-6-yl]-4-hydroxybenzamide
VQAFBYLFRCCWNB-GOSISDBHSA-N
CC1=C2C(=CC=C1)C(=CC3=C2[C@@H](CN3C(=O)C4=CN5C=C(C=CC5=N4)NC(=O)C6=CC=C(C=C6)O)CCl)O