Benzyl 4-hydroxybenzoate-2,3,5,6-d4 is a deuterated research compound used as a labeled analog for analytical and metabolic studies. Its structure features an ester of benzyl alcohol and 4-hydroxybenzoic acid with four deuterium atoms on the aromatic ring.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1219805-81-8
1-Bromononane-d19
deuterated alkyl bromide reference standard
2,4-dibromophenol-3,5,6-d3
isotope-labeled analytical standard
4,4'-DICHLOROBENZOPHENONE-D8
Deuterated analytical reference standard
Monoethyl Phthalate-d4
isotopically labeled research reference standard
بنزوات البنزيل
scabicide and insect repellent
Benzyl Salicylate-d4
Deuterated research reagent
4-(Benzyloxycarbonyl)phenylboronic acid
pharmaceutical intermediate for API synthesis
Benzyl Butyl Phthalate-d4
Deuterated analytical standard
benzyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate
MOZDKDIOPSPTBH-YKVCKAMESA-N
[2H]C1=C(C(=C(C(=C1C(=O)OCC2=CC=CC=C2)[2H])[2H])O)[2H]