Monoethyl Phthalate-d4 is a deuterium-labeled research reference standard used in analytical chemistry and environmental testing. It is the isotopically substituted form of monoethyl phthalate, with four hydrogen atoms replaced by deuterium, making it valuable for quantification and tracing studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1219806-03-7
1,2-Benzene-3,4,5,6-d4-dicarboxylic acid, diethyl ester
deuterated analytical reference standard
Dodecanoic-d23 acid
isotopically labeled research reference standard
3,4-Dihydroxyphenylacetic Acid-d5
isotopically labeled research reference standard
9-Amino-1,2,3,4-tetrahydroacridin-1-ol-d3
Deuterated research compound
Pyrazine-2,5-dicarboxylic acid
research compound
Tert-Butyldicyclohexylphosphonium tetrafluoroborate
phosphine ligand precursor
2-(2-Fluorophenyl)-3H-imidazo[4,5-c]pyridine methanesulfonate
research compound
2,3,4,5-tetradeuterio-6-ethoxycarbonylbenzoic acid
YWWHKOHZGJFMIE-LNFUJOGGSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC)[2H])[2H]