3,4-Dihydroxyphenylacetic Acid-d5 is a deuterium-labeled analog of 3,4-dihydroxyphenylacetic acid, used as an isotopically labeled research reference standard. It is characterized by five deuterium atoms incorporated at specific positions on the aromatic ring and the acetic acid side chain.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 60696-39-1
Dodecanoic-d23 acid
isotopically labeled research reference standard
Monoethyl Phthalate-d4
isotopically labeled research reference standard
Ethyldiphenylphosphine
organophosphine ligand for coordination chemistry
2-Nitro-1-naphthol
research compound
2,4-dichloroquinazoline
research compound
2-chloro-3,4-dihydroquinazolin-4-one
research compound
3,4-Dihydroxyphenylacetic acid
research compound for dopamine metabolism
2,2-dideuterio-2-(2,3,6-trideuterio-4,5-dihydroxyphenyl)acetic acid
CFFZDZCDUFSOFZ-QUWGTZMWSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])C(=O)O)[2H])O)O)[2H]
—