Benzyl Butyl Phthalate-d4 is a deuterated analytical standard, where four hydrogen atoms on the benzene ring are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry for the quantification of benzyl butyl phthalate in environmental or biological samples.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 93951-88-3
2,4,4'-Trimethyldiphenylamine
chemical intermediate
4-AMINO-5-AMINOMETHYL-2-METHYLPYRIMIDINE
precursor for thiamine biosynthesis
(4S,5S)-4-Isopropyl-2,2,5-trimethyl-1,3-dioxolane-4-carboxylic acid
pharmaceutical reference standard
SOMAN
Chemical warfare nerve agent
Benzyl Salicylate-d4
Deuterated research reagent
بنزوات البنزيل
scabicide and insect repellent
BENZYL 4-HYDROXYBENZOATE-2,3,5,6-D4
deuterated research compound
4-(Benzyloxycarbonyl)phenylboronic acid
pharmaceutical intermediate for API synthesis
2-O-benzyl 1-O-butyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
IRIAEXORFWYRCZ-CXRURWBMSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCC)C(=O)OCC2=CC=CC=C2)[2H])[2H]