Illudin S is a naturally occurring sesquiterpene compound found in certain poisonous mushrooms. It is primarily used as a research compound due to its unique molecular structure and biological activity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1149-99-1
1-Succinimidyl-3'-pyrenebutyrate
Fluorescent labeling reagent
Benzyltrimethylammonium dichloroiodate
Phase transfer catalyst
2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester
research compound
Triethyl orthopropionate
Organic synthesis reagent
Illudin M
research compound
(1R,2S,5R)-1,5-dihydroxy-2-(hydroxymethyl)-2,5,7-trimethylspiro[1H-indene-6,1'-cyclopropane]-4-one
DDLLIYKVDWPHJI-RDBSUJKOSA-N
CC1=C2[C@H]([C@](C=C2C(=O)[C@](C13CC3)(C)O)(C)CO)O