This compound is a chemical compound used primarily as a research reagent. It features an ester functional group and a cyclopentane ring, with a LogP of approximately 3.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1149760-04-2
1-isopropylcyclohexyl Methacrylate
monomer for polymer synthesis
Triethyl orthopropionate
Organic synthesis reagent
Glycidic acid
inhibitor of glycolate synthesis
2-Fluoro-3-(trifluoromethyl)benzoic acid
Research compound for Hammett equation studies
Ethyl 2-phenyl-2-((phenylcarbonothioyl)thio)acetate
Research reagent for RAFT polymerization
(1-propan-2-ylcyclopentyl) 2-methylprop-2-enoate
GPXHHBYETPIZOU-UHFFFAOYSA-N
CC(C)C1(CCCC1)OC(=O)C(=C)C
—