2-Fluoro-3-(trifluoromethyl)benzoic acid is a substituted benzoic acid derivative used in physical organic chemistry as a model compound for Hammett equation studies. Its structure, featuring both fluoro and trifluoromethyl substituents on the aromatic ring, makes it suitable for investigating the influence of electron-withdrawing groups on reaction rates and equilibria.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 115029-22-6
Ethyl 2-phenyl-2-((phenylcarbonothioyl)thio)acetate
Research reagent for RAFT polymerization
3-Nitroaniline-2,4,5,6-d4
deuterated research compound
2-nitrotoluene-3,4,5,6-d4
deuterated research compound
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine
Boronic acid ester for cross-coupling
2-fluoro-3-(trifluoromethyl)benzoic acid
XVEAMDNSCPPPCP-UHFFFAOYSA-N
C1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)O
—