2-Nitrotoluene-3,4,5,6-d4 is a deuterated research compound, specifically a tetradeuterated derivative of 2-nitrotoluene where four hydrogen atoms on the aromatic ring are replaced with deuterium. Its primary significance lies in its use as a labeled compound for analytical and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 115049-76-8
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine
Boronic acid ester for cross-coupling
1,8-diethyl-1-methyl-4,9-dihydro-3H-pyrano[3,4-b]indole
research compound
N-Succinimidyl 4-(2-pyridyldithio)butanoate
heterobifunctional crosslinker for conjugation
D-Luciferin potassium salt
bioluminescence assay reagent
2-Nitrotoluene
Production of dyes and rubber chemicals
1,2,3,4-tetradeuterio-5-methyl-6-nitrobenzene
PLAZTCDQAHEYBI-QFFDRWTDSA-N
[2H]C1=C(C(=C(C(=C1[2H])C)[N+](=O)[O-])[2H])[2H]