1-Succinimidyl-3'-pyrenebutyrate is a fluorescent labeling reagent. It consists of a pyrene fluorophore linked to an N-hydroxysuccinimide (NHS) ester reactive group, enabling covalent attachment to primary amines on biomolecules such as proteins or peptides.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 114932-60-4
Benzyltrimethylammonium dichloroiodate
Phase transfer catalyst
2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester
research compound
Triethyl orthopropionate
Organic synthesis reagent
Glycidic acid
inhibitor of glycolate synthesis
(2,5-dioxopyrrolidin-1-yl) 4-pyren-1-ylbutanoate
YBNMDCCMCLUHBL-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCCC2=C3C=CC4=CC=CC5=C4C3=C(C=C5)C=C2