4-Fluoro-L-phenylalanine is a fluorinated derivative of the amino acid phenylalanine, commonly used as a research reagent in amino acid studies. Its structure includes an aromatic ring with a fluorine substituent, contributing to its utility in biochemical and biophysical investigations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1132-68-9
(3S,4R)-1-METHYL-4-(2,4,6-TRIMETHOXYPHENYL)PIPERIDIN-3-OL
research compound
(5S)-N-(5-Amino-1-carboxypentyl)iminodiacetic Acid
analytical chelating agent
2,6-bis(N-pyrazolyl)pyridine nickel(II) bromide
research compound
1-Cyano-3-nitrosoguanidine
nitrosamine reference standard
4-Fluoro-D-phenylalanine
Fluorinated phenylalanine intermediate
(2S)-2-amino-3-(4-fluorophenyl)propanoic acid
XWHHYOYVRVGJJY-QMMMGPOBSA-N
C1=CC(=CC=C1C[C@@H](C(=O)O)N)F