This compound is a derivative of the amino acid lysine, modified with two carboxymethyl groups that enable it to bind metal ions. It is primarily used as an analytical chelating agent in research and laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 113231-05-3
2,6-bis(N-pyrazolyl)pyridine nickel(II) bromide
research compound
1-Cyano-3-nitrosoguanidine
nitrosamine reference standard
N-(6-BROMONAPHTHALEN-2-YL)METHANESULFONAMIDE
research compound
N-(6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)NAPHTHALEN-2-YL)METHANESULFONAMIDE
boronic acid pinacol ester research compound
(2S)-6-amino-2-[bis(carboxymethyl)amino]hexanoic acid
SYFQYGMJENQVQT-ZETCQYMHSA-N
C(CCN)C[C@@H](C(=O)O)N(CC(=O)O)CC(=O)O