4-Fluoro-D-phenylalanine is a fluorinated derivative of D-phenylalanine used as an intermediate in pharmaceutical manufacturing. Its structure features an aromatic ring with a fluorine substituent, contributing to its role in the synthesis of peptide-based compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 18125-46-7
3-bromo-4-chloropyridine hydrochloride
Pharmaceutical intermediate
Tert-Butyl 3-methyl-4-oxopiperidine-1-carboxylate
Pharmaceutical intermediate
3-(Carbamoylmethyl)-5-methylhexanoic acid
pharmaceutical intermediate
(3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid
pharmaceutical intermediate
4-FLUORO-L-PHENYLALANINE
Research reagent for amino acid studies
(2R)-2-amino-3-(4-fluorophenyl)propanoic acid
XWHHYOYVRVGJJY-MRVPVSSYSA-N
C1=CC(=CC=C1C[C@H](C(=O)O)N)F