This compound is a research reagent featuring an oxabicyclohexane core, a bicyclic structure that includes an oxygen-containing three-membered ring. It is primarily used in laboratory settings for chemical synthesis and structure-activity relationship studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 110567-22-1
Tyr-ile-gly-ser-arg
synthetic laminin pentapeptide research reagent
Morpholine-d8 Hydrochloride
deuterated solvent reference standard
Spacer Phosphoramidite C3
oligonucleotide synthesis reagent
(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride
isotope-labeled reference standard
(1S,2R,3S,5R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexane
YPDRJNPIGFCETD-WCIQWLHISA-N
C1[C@@H]2[C@@H](O2)[C@@H]([C@H]1OCC3=CC=CC=C3)COCC4=CC=CC=C4