Morpholine-d8 Hydrochloride is a deuterated research reagent used as a reference standard in nuclear magnetic resonance (NMR) spectroscopy. This isotopically labeled compound contains eight deuterium atoms, making it suitable for solvent calibration and analytical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1107650-56-5
MORPHOLINE-2,2,3,3,5,5,6,6-D8
deuterated research reagent
Spacer Phosphoramidite C3
oligonucleotide synthesis reagent
(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride
isotope-labeled reference standard
Potassium (R)-3-hydroxybutanoate
research chemical
Ethyl (2R)-oxirane-2-carboxylate
Research compound
2,2,6,6-d4-Morpholine
deuterated standard for analytical chemistry
مورفولين
Solvent and chemical intermediate
2,2,3,3,5,5,6,6-octadeuteriomorpholine;hydrochloride
JXYZHMPRERWTPM-PHHTYKMFSA-N
[2H]C1(C(OC(C(N1)([2H])[2H])([2H])[2H])([2H])[2H])[2H].Cl