Tyr-Ile-Gly-Ser-Arg (YIGSR) is a synthetic pentapeptide derived from the laminin molecule and is used as a research reagent. It corresponds to a sequence within the laminin β1 chain and is commonly employed in cell adhesion and migration studies due to its high polarity and multiple hydrogen-bond donors.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 110590-64-2
Morpholine-d8 Hydrochloride
deuterated solvent reference standard
Spacer Phosphoramidite C3
oligonucleotide synthesis reagent
(1R,2R)-2-[[bis(trideuteriomethyl)amino]methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol;hydrochloride
isotope-labeled reference standard
Potassium (R)-3-hydroxybutanoate
research chemical
(2S)-2-[[(2S)-2-[[2-[[(2S,3S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]acetyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid
MWOGMBZGFFZBMK-LJZWMIMPSA-N
CC[C@H](C)[C@@H](C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)NC(=O)[C@H](CC1=CC=C(C=C1)O)N