This compound is a salt-form pharmaceutical intermediate used in the production of bromhexine derivatives. It features a complex polycyclic structure containing amine, alcohol, and halogen functional groups.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 15942-08-2
Ambroxol EP Impurity B
Pharmaceutical intermediate for ambroxol
(2s)-1-[(tert-butoxy)carbonyl]piperazine-2-carboxylic acid
Boc-protected piperazine carboxylic acid intermediate
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
(2S)-6-azido-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid building block
(1R,2S)-1-(((1,1-Dimethylethoxy)carbonyl)amino)-2-ethenylcyclopropanecarboxylic acid
Pharmaceutical intermediate
Ambroxol Cyclic Impurity-d5 Dihydrochloride
n.a
4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol;hydrochloride
ICLHRFYBPXBCPE-UHFFFAOYSA-N
C1CC(CCC1N2CC3=C(C(=CC(=C3)Br)Br)NC2)O.Cl