1,10-Decanedioic-d16 acid is a deuterated analytical reference standard, chemically a hexadecadeuterio-labeled form of decanedioic acid. It is primarily used in research and laboratory settings as a stable isotope-labeled compound for analytical method development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,10-DECANEDIOIC-D16 ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Nonanedioic-D14 Acid
deuterated analytical reference standard
1,14-TETRADECANEDIOIC-D24 ACID
stable isotope labeled research compound
Hexadecanedioic acid-d28
deuterated reference standard
1,8-OCTANEDIOIC-D12 ACID
deuterated analytical reference standard
Tert-Butylamine borane
Borane reducing agent complex
3-Bromobenzothiophene
Research compound for chemical synthesis
Trans-2,3-Dimethoxycinnamic acid
research compound
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecadeuteriodecanedioic acid
CXMXRPHRNRROMY-SADLKCKLSA-N
[2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O
1,10-DECANEDIOIC-D16 ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.