3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid is a compound used as a biological buffer reagent. It functions as an amine-containing sulfonic acid derivative, commonly employed in laboratory and research settings to maintain pH stability.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 73463-39-5
4-Morpholinepropanesulfonic acid, sodium salt
biological buffer reagent
ADA sodium salt
biological buffer reagent
TAPSO sodium salt
biological buffer reagent
MES potassium salt
biological buffer reagent
Rhodium(II) Octanoate Dimer
research compound
1,2,3,4,5,6,7-heptadeuterioindole
Deuterated indole for research use
(S)-butane-1,2-diol
research compound
Cortisol-9,11,12,12-d4
Deuterated internal standard for analysis
3-(cyclohexylamino)-2-hydroxypropane-1-sulfonic acid
INEWUCPYEUEQTN-UHFFFAOYSA-N
C1CCC(CC1)NCC(CS(=O)(=O)O)O