3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid is a compound used as a biological buffer reagent. It functions as an amine-containing sulfonic acid derivative, commonly employed in laboratory and research settings to maintain pH stability.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Morpholinepropanesulfonic acid, sodium salt
biological buffer reagent
ADA sodium salt
biological buffer reagent
TAPSO sodium salt
biological buffer reagent
MES potassium salt
biological buffer reagent
Rhodium(II) Octanoate Dimer
research compound
1,2,3,4,5,6,7-heptadeuterioindole
Deuterated indole for research use
(S)-butane-1,2-diol
research compound
Cortisol-9,11,12,12-d4
Deuterated internal standard for analysis
3-(cyclohexylamino)-2-hydroxypropane-1-sulfonic acid
INEWUCPYEUEQTN-UHFFFAOYSA-N
C1CCC(CC1)NCC(CS(=O)(=O)O)O
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.