ADA sodium salt is a sodium salt form of ADA, a zwitterionic compound commonly used as a biological buffer reagent in biochemical and molecular biology research. It is valued for its ability to maintain stable pH in the physiological range.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 7415-22-7
MES potassium salt
biological buffer reagent
POPSO
biological buffer reagent
TES sodium salt
biological buffer reagent
4-Morpholinepropanesulfonic acid, sodium salt
biological buffer reagent
Guanosine-5'-diphosphate disodium salt
nucleoside diphosphate research reagent
2-[(1S,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol
Certified reference standard
Aldosterone 18-Oxime 21-Acetate
aldosterone impurity reference standard
(-)-o-Tyrosine
Research reference standard
sodium 2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]acetate
QCGKKVWCABJQQI-UHFFFAOYSA-M
C(C(=O)N)N(CC(=O)O)CC(=O)[O-].[Na+]