TAPSO sodium salt is a sodium salt of a sulfonic acid buffering agent. It is commonly utilized as a biological buffer reagent in research and laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
TAPSO sodium salt 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
MES potassium salt
biological buffer reagent
DIPSO sodium salt
biological buffer reagent
POPSO
biological buffer reagent
TES sodium salt
biological buffer reagent
5-Chloroindole-2-carboxylic acid
indolyl carboxylic acid reagent
3,5-Difluorophenylacetic acid
research compound
2-Propenoic acid, 2-phosphonoxy-, monocyclohexylammonium salt
Research compound
Guanosine 5'-triphosphate-5'-adenosine
Nucleoside polyphosphate research reagent
sodium 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-hydroxypropane-1-sulfonate
XRADYQRMWVBZEH-UHFFFAOYSA-M
C(C(CS(=O)(=O)[O-])O)NC(CO)(CO)CO.[Na+]
TAPSO sodium salt 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.