DIPSO sodium salt is a biological buffer reagent used in research and laboratory applications. It is the sodium salt form of 3-[bis(2-hydroxyethyl)amino]-2-hydroxypropane-1-sulfonate, a zwitterionic compound suitable for maintaining pH in biochemical experiments.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
DIPSO sodium salt 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
TAPSO sodium salt
biological buffer reagent
MES potassium salt
biological buffer reagent
N-Cyclohexyltaurine
biological buffer reagent
POPSO
biological buffer reagent
2'-Deoxyguanosine-5'-diphosphate trisodium salt
metabolite reference standard
2'-deoxyuridine 5'-diphosphate sodium salt
nucleotide research reagent
DUTP
endogenous metabolite used in research
3-[2-[[(2-Methoxyphenyl)methyl]amino]ethyl]-2,4(1H,3H)-quinazolinedione
Research compound
sodium 3-[bis(2-hydroxyethyl)amino]-2-hydroxypropane-1-sulfonate
UASJMJKAMKICKL-UHFFFAOYSA-M
C(CO)N(CCO)CC(CS(=O)(=O)[O-])O.[Na+]
DIPSO sodium salt 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.