trans-2,3-Dimethoxycinnamic acid is a research compound that features a cinnamic acid backbone with two methoxy substituents on the aromatic ring. It is primarily used as a laboratory reagent in chemical and pharmaceutical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Trans-2,3-Dimethoxycinnamic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
Rhodium(II) Octanoate Dimer
research compound
1,2,3,4,5,6,7-heptadeuterioindole
Deuterated indole for research use
(S)-butane-1,2-diol
research compound
(E)-3-(2,3-dimethoxyphenyl)prop-2-enoic acid
QAXPUWGAGVERSJ-VOTSOKGWSA-N
COC1=CC=CC(=C1OC)/C=C/C(=O)O
Trans-2,3-Dimethoxycinnamic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.