1,8-Octanedioic-d12 acid is a deuterated analytical reference standard, specifically the dodecadeuterio-labeled form of octanedioic acid. It is primarily used in research and analytical laboratories for quantification and identification purposes via mass spectrometry or other deuterium-sensitive techniques.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,8-OCTANEDIOIC-D12 ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,10-DECANEDIOIC-D16 ACID
Deuterated analytical reference standard
Nonanedioic-D14 Acid
deuterated analytical reference standard
1,14-TETRADECANEDIOIC-D24 ACID
stable isotope labeled research compound
Hexadecanedioic acid-d28
deuterated reference standard
3-Chloropentane-2,4-dione
synthetic intermediate
(4aS,7aR)-Octahydro-1H-pyrrolo[3,4-b]pyridine
Research compound
(+/-)-Amphetamine-d10
deuterated analytical reference standard
N,1,1,1,2,3-hexadeuterio-3-phenyl-N-(trideuteriomethyl)propan-2-amine
deuterated reference standard
2,2,3,3,4,4,5,5,6,6,7,7-dodecadeuteriooctanedioic acid
TYFQFVWCELRYAO-LBTWDOQPSA-N
[2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O
1,8-OCTANEDIOIC-D12 ACID 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.