This compound is a deuterated reference standard, specifically a labeled form of N-methyl-1-phenylpropan-2-amine, where multiple hydrogen atoms are replaced with deuterium. It is primarily used in analytical chemistry and research as an internal standard for mass spectrometry or nuclear magnetic resonance spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Fmoc-Phe-Gly-OH
Peptide building block
2,4-Diphenyl-6-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1,3,5-triazine
research compound
Carbonylchlorohydrotris(triphenylphosphine)ruthenium
research compound for coordination chemistry
Bucladesine sodium
phosphodiesterase inhibitor research tool
(+/-)-Methamphetamine-d14
mass spectrometry internal standard
DL-Methamphetamine
active pharmaceutical ingredient
N,1,1,1,2,3-hexadeuterio-3-phenyl-N-(trideuteriomethyl)propan-2-amine
MYWUZJCMWCOHBA-FUUWYYHRSA-N
[2H]C(C1=CC=CC=C1)C([2H])(C([2H])([2H])[2H])N([2H])C([2H])([2H])[2H]
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.