Fmoc-Phe-Gly-OH is a research reagent and peptide building block used primarily in solid-phase peptide synthesis. It features a protected amino group and aromatic ring systems, supporting its role in constructing peptides with specific sequences.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Fmoc-Phe-Gly-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,4-Diphenyl-6-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1,3,5-triazine
research compound
Carbonylchlorohydrotris(triphenylphosphine)ruthenium
research compound for coordination chemistry
Bucladesine sodium
phosphodiesterase inhibitor research tool
6-Bromo-5,7-difluoroindoline-2,3-dione
research compound
2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]acetic acid
WJQWIPAQNBOEBX-QHCPKHFHSA-N
C1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Fmoc-Phe-Gly-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.