S-Adenosyl-L-methionine-d3 is a stable isotope labeled research compound. It is a deuterated form of S-adenosylmethionine, featuring three deuterium atoms incorporated into its structure, and is used in laboratory studies as an analytical reference or tracer.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 68684-40-2
Urea-13C,15N2
stable isotope labeled research compound
D6-25-hydroxyvitamin D3
stable isotope labeled research compound
1,2,4-TRIMETHYLBENZENE-D12
stable isotope labeled research compound
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
4-Toluidine-d7 (Major)
deuterated research standard
Tetraethylammonium chloride monohydrate
Quaternary ammonium salt electrolyte
Dideoxy GTP
DNA sequencing reagent
Boc-2-aminobenzoic acid
research compound
(2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-(trideuteriomethyl)sulfonio]butanoate
MEFKEPWMEQBLKI-JSJAHMFWSA-N
[2H]C([2H])([2H])[S+](CC[C@@H](C(=O)[O-])N)C[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O