1,2,4-Trimethylbenzene-d12 is a stable isotope labeled research compound where all twelve hydrogen atoms are replaced with deuterium. It is primarily used as a labeled analog in analytical chemistry and metabolic studies to trace the behavior of the parent compound.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1,2,4-TRIMETHYLBENZENE-D12 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4,6-Dichloro-1,3-dinitrobenzene-13C6
stable isotope labeled research compound
(2R,3R,5R)-5-(6-Aminopurin-9-yl)-2-(hydroxymethyl)(2,3,4,5-13C4)oxolan-3-ol;hydrate
stable isotope labeled research compound
L-Tyrosine D4
stable isotope labeled research compound
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
2,3-Dimethylpyridine-d9
Deuterated research compound
(Rac)-Cotinine-d4
isotopically labeled analytical reference standard
4-Aminobenzoic Acid-d4
labeled reference standard
2,6-DIMETHYLNAPHTHALENE-D12
deuterated research reference standard
1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene
GWHJZXXIDMPWGX-ZPMNDIOMSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H]
1,2,4-TRIMETHYLBENZENE-D12 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.