4-Cholesten-3-one-4-13C is a carbon-13 labeled derivative of 4-cholesten-3-one, a steroid compound. It is primarily used as a stable isotope labeled research compound in analytical and metabolic studies, where the isotopic label enables tracking or quantification in complex biological matrices.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-CHOLESTEN-3-ONE-4-13C 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
21-Hydroxy-20-methylpregn-4-en-3-one
pharmaceutical intermediate
D6-25-hydroxyvitamin D3
stable isotope labeled research compound
S-Adenosyl-L-methionine-d3
stable isotope labeled research compound
Urea-13C,15N2
stable isotope labeled research compound
Palmitoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
SPDP
heterobifunctional crosslinking reagent
P-Nitrophenyl phosphate di(tris(hydroxymethyl)methylamine) salt
phosphatase substrate
POPSO
biological buffer reagent
(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
NYOXRYYXRWJDKP-HLMQNULZSA-N
C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=[13CH]C(=O)CC[C@]34C)C
4-CHOLESTEN-3-ONE-4-13C 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.