21-Hydroxy-20-methylpregn-4-en-3-one is a steroid compound used as a pharmaceutical intermediate. It is characterized by a cyclopenta[a]phenanthrene core with a ketone group and a secondary alcohol side chain.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 60966-36-1
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
1,3,5-Benzenetriol, dihydrate
Pharmaceutical and explosive synthesis intermediate
4-Hydroxyphthalic acid
pharmaceutical intermediate
4-Amino-3-nitrophenol
pharmaceutical intermediate
Methyl 2-iodobenzoate
Pharmaceutical intermediate for synthesis
(8S,9S,10R,13S,14S,17R)-17-(1-hydroxypropan-2-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
ZNWOYQVXPIEQRC-ZRFCQXGJSA-N
CC(CO)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C