2,3-Dimethylpyridine-d9 is a deuterated research compound where all hydrogen atoms in the methyl groups and the pyridine ring have been replaced with deuterium. It is primarily used as a stable isotope-labeled reagent in analytical and laboratory research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,3-Dimethylpyridine-d9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Methylimidazole-d6
Deuterated research compound
4-N-PROPYLPHENOL-D12
Deuterated research compound
2,6-DICHLOROTOLUENE-3,4,5-D3
Deuterated research compound
2-Bromo(2-~2~H)propane
Deuterated research compound
(Rac)-Cotinine-d4
isotopically labeled analytical reference standard
4-Aminobenzoic Acid-d4
labeled reference standard
2,6-DIMETHYLNAPHTHALENE-D12
deuterated research reference standard
Kynurenic Acid-d5
deuterated research compound
2,3,4-trideuterio-5,6-bis(trideuteriomethyl)pyridine
HPYNZHMRTTWQTB-XVGWXEQOSA-N
[2H]C1=C(C(=C(N=C1[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H]
2,3-Dimethylpyridine-d9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.