This compound is a carbon-13 labeled version of 4,6-dichloro-1,3-dinitrobenzene, used as a stable isotope labeled research compound. It is primarily employed in analytical and environmental studies where isotopic tracking is required.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4,6-Dichloro-1,3-dinitrobenzene-13C6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,2,4-TRIMETHYLBENZENE-D12
stable isotope labeled research compound
(2R,3R,5R)-5-(6-Aminopurin-9-yl)-2-(hydroxymethyl)(2,3,4,5-13C4)oxolan-3-ol;hydrate
stable isotope labeled research compound
L-Tyrosine D4
stable isotope labeled research compound
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
(3-Chloroprop-1-yn-1-yl)benzene
research compound
Methyl (methylsulfinyl)methyl sulfide
research compound
6-BROMO-DL-TRYPTOPHAN
research compound
Heptafluorobutyric anhydride
derivatising reagent for gas chromatography
1,5-dichloro-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene
ZPXDNSYFDIHPOJ-IDEBNGHGSA-N
[13CH]1=[13C]([13C](=[13CH][13C](=[13C]1[N+](=O)[O-])Cl)Cl)[N+](=O)[O-]
—
4,6-Dichloro-1,3-dinitrobenzene-13C6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.